C9H15BrN2S — CID 115201662
N'-(5-bromothiophen-2-yl)-N-methylbutane-1,4-diamine (PubChem CID 115201662) has the molecular formula C9H15BrN2S and a molecular weight of 263.20 g/mol. Its IUPAC name is N'-(5-bromothiophen-2-yl)-N-methylbutane-1,4-diamine.
| Compound Name | N'-(5-bromothiophen-2-yl)-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115201662 |
| Molecular Formula | C9H15BrN2S |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | N'-(5-bromothiophen-2-yl)-N-methylbutane-1,4-diamine |
| SMILES | CNCCCCNc1ccc(Br)s1 |
| InChI | InChI=1S/C9H15BrN2S/c1-11-6-2-3-7-12-9-5-4-8(10)13-9/h4-5,11-12H,2-3,6-7H2,1H3 |
| InChIKey | VQWPBMKKYKVPDO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|