C10H17ClN2S — CID 115201788
N'-(5-chlorothiophen-2-yl)-N,N'-dimethylbutane-1,4-diamine (PubChem CID 115201788) has the molecular formula C10H17ClN2S and a molecular weight of 232.78 g/mol. Its IUPAC name is N'-(5-chlorothiophen-2-yl)-N,N'-dimethylbutane-1,4-diamine.
| Compound Name | N'-(5-chlorothiophen-2-yl)-N,N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115201788 |
| Molecular Formula | C10H17ClN2S |
| Molecular Weight | 232.78 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N'-(5-chlorothiophen-2-yl)-N,N'-dimethylbutane-1,4-diamine |
| SMILES | CNCCCCN(C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H17ClN2S/c1-12-7-3-4-8-13(2)10-6-5-9(11)14-10/h5-6,12H,3-4,7-8H2,1-2H3 |
| InChIKey | QNQHDYPFUGTUSS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|