C7H11ClN2S — CID 115226650
N'-(5-chlorothiophen-2-yl)-N,N'-dimethylmethanediamine (PubChem CID 115226650) has the molecular formula C7H11ClN2S and a molecular weight of 190.70 g/mol. Its IUPAC name is N'-(5-chlorothiophen-2-yl)-N,N'-dimethylmethanediamine.
| Compound Name | N'-(5-chlorothiophen-2-yl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 115226650 |
| Molecular Formula | C7H11ClN2S |
| Molecular Weight | 190.70 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | N'-(5-chlorothiophen-2-yl)-N,N'-dimethylmethanediamine |
| SMILES | CNCN(C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C7H11ClN2S/c1-9-5-10(2)7-4-3-6(8)11-7/h3-4,9H,5H2,1-2H3 |
| InChIKey | HKXDVXDMKGJRAA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.70 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|