C16H28N2 — CID 115203171
N'-[(4-butan-2-ylphenyl)methyl]-2-methylbutane-1,4-diamine (PubChem CID 115203171) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N'-[(4-butan-2-ylphenyl)methyl]-2-methylbutane-1,4-diamine.
| Compound Name | N'-[(4-butan-2-ylphenyl)methyl]-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115203171 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N'-[(4-butan-2-ylphenyl)methyl]-2-methylbutane-1,4-diamine |
| SMILES | CCC(C)c1ccc(CNCCC(C)CN)cc1 |
| InChI | InChI=1S/C16H28N2/c1-4-14(3)16-7-5-15(6-8-16)12-18-10-9-13(2)11-17/h5-8,13-14,18H,4,9-12,17H2,1-3H3 |
| InChIKey | XGXYDWKZYCEVBM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|