C17H24N2 — CID 115245245
1-[[(4-butan-2-ylphenyl)methylamino]methyl]cyclobutane-1-carbonitrile (PubChem CID 115245245) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-[[(4-butan-2-ylphenyl)methylamino]methyl]cyclobutane-1-carbonitrile.
| Compound Name | 1-[[(4-butan-2-ylphenyl)methylamino]methyl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 115245245 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1-[[(4-butan-2-ylphenyl)methylamino]methyl]cyclobutane-1-carbonitrile |
| SMILES | CCC(C)c1ccc(CNCC2(C#N)CCC2)cc1 |
| InChI | InChI=1S/C17H24N2/c1-3-14(2)16-7-5-15(6-8-16)11-19-13-17(12-18)9-4-10-17/h5-8,14,19H,3-4,9-11,13H2,1-2H3 |
| InChIKey | GEEBNCZAVHVRTJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |