C14H25N3 — CID 115203531
2-methyl-N'-(2-methyl-2-pyridin-2-ylpropyl)butane-1,4-diamine (PubChem CID 115203531) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is 2-methyl-N'-(2-methyl-2-pyridin-2-ylpropyl)butane-1,4-diamine.
| Compound Name | 2-methyl-N'-(2-methyl-2-pyridin-2-ylpropyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 115203531 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2-methyl-N'-(2-methyl-2-pyridin-2-ylpropyl)butane-1,4-diamine |
| SMILES | CC(CN)CCNCC(C)(C)c1ccccn1 |
| InChI | InChI=1S/C14H25N3/c1-12(10-15)7-9-16-11-14(2,3)13-6-4-5-8-17-13/h4-6,8,12,16H,7,9-11,15H2,1-3H3 |
| InChIKey | ZUGWRXKOMIFMFH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|