C15H24BrFN2 — CID 115203524
N'-[2-(5-bromo-2-fluorophenyl)-2-methylpropyl]-2-methylbutane-1,4-diamine (PubChem CID 115203524) has the molecular formula C15H24BrFN2 and a molecular weight of 331.27 g/mol. Its IUPAC name is N'-[2-(5-bromo-2-fluorophenyl)-2-methylpropyl]-2-methylbutane-1,4-diamine.
| Compound Name | N'-[2-(5-bromo-2-fluorophenyl)-2-methylpropyl]-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115203524 |
| Molecular Formula | C15H24BrFN2 |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N'-[2-(5-bromo-2-fluorophenyl)-2-methylpropyl]-2-methylbutane-1,4-diamine |
| SMILES | CC(CN)CCNCC(C)(C)c1cc(Br)ccc1F |
| InChI | InChI=1S/C15H24BrFN2/c1-11(9-18)6-7-19-10-15(2,3)13-8-12(16)4-5-14(13)17/h4-5,8,11,19H,6-7,9-10,18H2,1-3H3 |
| InChIKey | UNHCBCVATXFJGH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|