C13H23BrN2S — CID 115203523
N'-[2-(4-bromothiophen-2-yl)-2-methylpropyl]-2-methylbutane-1,4-diamine (PubChem CID 115203523) has the molecular formula C13H23BrN2S and a molecular weight of 319.31 g/mol. Its IUPAC name is N'-[2-(4-bromothiophen-2-yl)-2-methylpropyl]-2-methylbutane-1,4-diamine.
| Compound Name | N'-[2-(4-bromothiophen-2-yl)-2-methylpropyl]-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115203523 |
| Molecular Formula | C13H23BrN2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N'-[2-(4-bromothiophen-2-yl)-2-methylpropyl]-2-methylbutane-1,4-diamine |
| SMILES | CC(CN)CCNCC(C)(C)c1cc(Br)cs1 |
| InChI | InChI=1S/C13H23BrN2S/c1-10(7-15)4-5-16-9-13(2,3)12-6-11(14)8-17-12/h6,8,10,16H,4-5,7,9,15H2,1-3H3 |
| InChIKey | ZOTBOJCIZMOESO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|