C17H30N2 — CID 115203855
1-N-[(4-tert-butyl-2-methylphenyl)methyl]pentane-1,4-diamine (PubChem CID 115203855) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 1-N-[(4-tert-butyl-2-methylphenyl)methyl]pentane-1,4-diamine.
| Compound Name | 1-N-[(4-tert-butyl-2-methylphenyl)methyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 115203855 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 1-N-[(4-tert-butyl-2-methylphenyl)methyl]pentane-1,4-diamine |
| SMILES | Cc1cc(C(C)(C)C)ccc1CNCCCC(C)N |
| InChI | InChI=1S/C17H30N2/c1-13-11-16(17(3,4)5)9-8-15(13)12-19-10-6-7-14(2)18/h8-9,11,14,19H,6-7,10,12,18H2,1-5H3 |
| InChIKey | ZTCAKUOJDIRPAM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|