C16H27BrN2 — CID 115205088
N'-[2-(4-bromophenyl)-2-methylpropyl]-2,2-dimethylbutane-1,4-diamine (PubChem CID 115205088) has the molecular formula C16H27BrN2 and a molecular weight of 327.31 g/mol. Its IUPAC name is N'-[2-(4-bromophenyl)-2-methylpropyl]-2,2-dimethylbutane-1,4-diamine.
| Compound Name | N'-[2-(4-bromophenyl)-2-methylpropyl]-2,2-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115205088 |
| Molecular Formula | C16H27BrN2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N'-[2-(4-bromophenyl)-2-methylpropyl]-2,2-dimethylbutane-1,4-diamine |
| SMILES | CC(C)(CN)CCNCC(C)(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H27BrN2/c1-15(2,11-18)9-10-19-12-16(3,4)13-5-7-14(17)8-6-13/h5-8,19H,9-12,18H2,1-4H3 |
| InChIKey | RXDOSEDGTUEBEM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|