C16H28N2 — CID 115200921
3-methyl-1-N-[2-methyl-2-(4-methylphenyl)propyl]butane-1,3-diamine (PubChem CID 115200921) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 3-methyl-1-N-[2-methyl-2-(4-methylphenyl)propyl]butane-1,3-diamine.
| Compound Name | 3-methyl-1-N-[2-methyl-2-(4-methylphenyl)propyl]butane-1,3-diamine |
|---|---|
| PubChem CID | 115200921 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 3-methyl-1-N-[2-methyl-2-(4-methylphenyl)propyl]butane-1,3-diamine |
| SMILES | Cc1ccc(C(C)(C)CNCCC(C)(C)N)cc1 |
| InChI | InChI=1S/C16H28N2/c1-13-6-8-14(9-7-13)15(2,3)12-18-11-10-16(4,5)17/h6-9,18H,10-12,17H2,1-5H3 |
| InChIKey | VARQVSLMJJTGQA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|