C16H27FN2 — CID 115205521
1-N-[2-(4-fluorophenyl)-2-methylpropyl]-4-methylpentane-1,4-diamine (PubChem CID 115205521) has the molecular formula C16H27FN2 and a molecular weight of 266.40 g/mol. Its IUPAC name is 1-N-[2-(4-fluorophenyl)-2-methylpropyl]-4-methylpentane-1,4-diamine.
| Compound Name | 1-N-[2-(4-fluorophenyl)-2-methylpropyl]-4-methylpentane-1,4-diamine |
|---|---|
| PubChem CID | 115205521 |
| Molecular Formula | C16H27FN2 |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 1-N-[2-(4-fluorophenyl)-2-methylpropyl]-4-methylpentane-1,4-diamine |
| SMILES | CC(C)(N)CCCNCC(C)(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H27FN2/c1-15(2,13-6-8-14(17)9-7-13)12-19-11-5-10-16(3,4)18/h6-9,19H,5,10-12,18H2,1-4H3 |
| InChIKey | BOXJBDYHDMLWJI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|