C14H25BrN2S — CID 115205523
1-N-[2-(5-bromothiophen-2-yl)-2-methylpropyl]-4-methylpentane-1,4-diamine (PubChem CID 115205523) has the molecular formula C14H25BrN2S and a molecular weight of 333.34 g/mol. Its IUPAC name is 1-N-[2-(5-bromothiophen-2-yl)-2-methylpropyl]-4-methylpentane-1,4-diamine.
| Compound Name | 1-N-[2-(5-bromothiophen-2-yl)-2-methylpropyl]-4-methylpentane-1,4-diamine |
|---|---|
| PubChem CID | 115205523 |
| Molecular Formula | C14H25BrN2S |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-N-[2-(5-bromothiophen-2-yl)-2-methylpropyl]-4-methylpentane-1,4-diamine |
| SMILES | CC(C)(N)CCCNCC(C)(C)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H25BrN2S/c1-13(2,11-6-7-12(15)18-11)10-17-9-5-8-14(3,4)16/h6-7,17H,5,8-10,16H2,1-4H3 |
| InChIKey | IDWHSDSKDZUSEG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|