C11H17BrN2 — CID 115205674
N'-(4-bromophenyl)-N-ethyl-N'-methylethane-1,2-diamine (PubChem CID 115205674) has the molecular formula C11H17BrN2 and a molecular weight of 257.18 g/mol. Its IUPAC name is N'-(4-bromophenyl)-N-ethyl-N'-methylethane-1,2-diamine.
| Compound Name | N'-(4-bromophenyl)-N-ethyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 115205674 |
| Molecular Formula | C11H17BrN2 |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | N'-(4-bromophenyl)-N-ethyl-N'-methylethane-1,2-diamine |
| SMILES | CCNCCN(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H17BrN2/c1-3-13-8-9-14(2)11-6-4-10(12)5-7-11/h4-7,13H,3,8-9H2,1-2H3 |
| InChIKey | OSJZTQZCPBTZDC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|