C18H24N2 — CID 115212078
2,3,5,6-tetramethyl-N-[[3-(methylamino)phenyl]methyl]aniline (PubChem CID 115212078) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-N-[[3-(methylamino)phenyl]methyl]aniline.
| Compound Name | 2,3,5,6-tetramethyl-N-[[3-(methylamino)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 115212078 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2,3,5,6-tetramethyl-N-[[3-(methylamino)phenyl]methyl]aniline |
| SMILES | CNc1cccc(CNc2c(C)c(C)cc(C)c2C)c1 |
| InChI | InChI=1S/C18H24N2/c1-12-9-13(2)15(4)18(14(12)3)20-11-16-7-6-8-17(10-16)19-5/h6-10,19-20H,11H2,1-5H3 |
| InChIKey | TWFAZGJYBBRUJY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |