C17H21N — CID 116925902
N-methyl-3-[(2,4,5-trimethylphenyl)methyl]aniline (PubChem CID 116925902) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is N-methyl-3-[(2,4,5-trimethylphenyl)methyl]aniline.
| Compound Name | N-methyl-3-[(2,4,5-trimethylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 116925902 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-methyl-3-[(2,4,5-trimethylphenyl)methyl]aniline |
| SMILES | CNc1cccc(Cc2cc(C)c(C)cc2C)c1 |
| InChI | InChI=1S/C17H21N/c1-12-8-14(3)16(9-13(12)2)10-15-6-5-7-17(11-15)18-4/h5-9,11,18H,10H2,1-4H3 |
| InChIKey | GMJCUPPXWAVURY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |