About 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene
2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene (PubChem CID 11521300) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene.
Molecular Properties
| Compound Name | 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene |
| PubChem CID | 11521300 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene |
| SMILES | C=CCC1(OO)CCc2ccccc2O1 |
| InChI | InChI=1S/C12H14O3/c1-2-8-12(15-13)9-7-10-5-3-4-6-11(10)14-12/h2-6,13H,1,7-9H2 |
| InChIKey | ZQMOZFXGYPVUMN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene?
The IUPAC name of 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene (CID 11521300) is 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene.
What is the SMILES notation for 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene?
The canonical SMILES for 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene is C=CCC1(OO)CCc2ccccc2O1.
What is the InChIKey of 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene?
The InChIKey is ZQMOZFXGYPVUMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-2-8-12(15-13)9-7-10-5-3-4-6-11(10)14-12/h2-6,13H,1,7-9H2.
What are the key properties of 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene?
2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene has a molecular weight of 206.24 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroperoxy-2-prop-2-enyl-3,4-dihydrochromene is sourced from PubChem (CID 11521300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).