C16H26 — CID 11521394
(2E,7E)-6-butyl-7-ethyldeca-2,4,5,7-tetraene (PubChem CID 11521394) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (2E,7E)-6-butyl-7-ethyldeca-2,4,5,7-tetraene.
| Compound Name | (2E,7E)-6-butyl-7-ethyldeca-2,4,5,7-tetraene |
|---|---|
| PubChem CID | 11521394 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (2E,7E)-6-butyl-7-ethyldeca-2,4,5,7-tetraene |
| SMILES | C/C=C/C=C=C(CCCC)/C(=C/CC)CC |
| InChI | InChI=1S/C16H26/c1-5-9-11-14-16(13-10-6-2)15(8-4)12-7-3/h5,9,11-12H,6-8,10,13H2,1-4H3/b9-5+,15-12+ |
| InChIKey | QYTAWRLFAYKBIZ-KJCDSFJNSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|