C11H16ClNO — CID 115214635
N-(2-chloroethyl)-2-methoxy-4,6-dimethylaniline (PubChem CID 115214635) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is N-(2-chloroethyl)-2-methoxy-4,6-dimethylaniline.
| Compound Name | N-(2-chloroethyl)-2-methoxy-4,6-dimethylaniline |
|---|---|
| PubChem CID | 115214635 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | N-(2-chloroethyl)-2-methoxy-4,6-dimethylaniline |
| SMILES | COc1cc(C)cc(C)c1NCCCl |
| InChI | InChI=1S/C11H16ClNO/c1-8-6-9(2)11(13-5-4-12)10(7-8)14-3/h6-7,13H,4-5H2,1-3H3 |
| InChIKey | SUFGYRZKJRQIIV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|