C11H14ClNS — CID 115214647
N-(2-chloroethyl)-3,4-dihydro-2H-thiochromen-6-amine (PubChem CID 115214647) has the molecular formula C11H14ClNS and a molecular weight of 227.76 g/mol. Its IUPAC name is N-(2-chloroethyl)-3,4-dihydro-2H-thiochromen-6-amine.
| Compound Name | N-(2-chloroethyl)-3,4-dihydro-2H-thiochromen-6-amine |
|---|---|
| PubChem CID | 115214647 |
| Molecular Formula | C11H14ClNS |
| Molecular Weight | 227.76 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | N-(2-chloroethyl)-3,4-dihydro-2H-thiochromen-6-amine |
| SMILES | ClCCNc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C11H14ClNS/c12-5-6-13-10-3-4-11-9(8-10)2-1-7-14-11/h3-4,8,13H,1-2,5-7H2 |
| InChIKey | PNHCTUYOCJGKLG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.76 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|