C15H14FNS — CID 43194251
N-(3-fluorophenyl)-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 43194251) has the molecular formula C15H14FNS and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-(3-fluorophenyl)-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 43194251 |
| Molecular Formula | C15H14FNS |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-(3-fluorophenyl)-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | Fc1cccc(NC2CCSc3ccccc32)c1 |
| InChI | InChI=1S/C15H14FNS/c16-11-4-3-5-12(10-11)17-14-8-9-18-15-7-2-1-6-13(14)15/h1-7,10,14,17H,8-9H2 |
| InChIKey | AUHVLRWACXKRPN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |