C16H26ClN — CID 115214949
N-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-chloro-N-methylethanamine (PubChem CID 115214949) has the molecular formula C16H26ClN and a molecular weight of 267.84 g/mol. Its IUPAC name is N-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-chloro-N-methylethanamine.
| Compound Name | N-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-chloro-N-methylethanamine |
|---|---|
| PubChem CID | 115214949 |
| Molecular Formula | C16H26ClN |
| Molecular Weight | 267.84 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-chloro-N-methylethanamine |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1CN(C)CCCl |
| InChI | InChI=1S/C16H26ClN/c1-12-9-14(16(3,4)5)10-13(2)15(12)11-18(6)8-7-17/h9-10H,7-8,11H2,1-6H3 |
| InChIKey | DFNLNCFFCWHJBL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.84 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|