C15H24ClN — CID 115215348
N-(2-chloroethyl)-2-methyl-2-(2,3,4-trimethylphenyl)propan-1-amine (PubChem CID 115215348) has the molecular formula C15H24ClN and a molecular weight of 253.82 g/mol. Its IUPAC name is N-(2-chloroethyl)-2-methyl-2-(2,3,4-trimethylphenyl)propan-1-amine.
| Compound Name | N-(2-chloroethyl)-2-methyl-2-(2,3,4-trimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 115215348 |
| Molecular Formula | C15H24ClN |
| Molecular Weight | 253.82 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N-(2-chloroethyl)-2-methyl-2-(2,3,4-trimethylphenyl)propan-1-amine |
| SMILES | Cc1ccc(C(C)(C)CNCCCl)c(C)c1C |
| InChI | InChI=1S/C15H24ClN/c1-11-6-7-14(13(3)12(11)2)15(4,5)10-17-9-8-16/h6-7,17H,8-10H2,1-5H3 |
| InChIKey | USUUODZALCVRBH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.82 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|