C8H13ClN2 — CID 115215519
N-(3-chloropropyl)-N-methyl-1H-pyrrol-2-amine (PubChem CID 115215519) has the molecular formula C8H13ClN2 and a molecular weight of 172.66 g/mol. Its IUPAC name is N-(3-chloropropyl)-N-methyl-1H-pyrrol-2-amine.
| Compound Name | N-(3-chloropropyl)-N-methyl-1H-pyrrol-2-amine |
|---|---|
| PubChem CID | 115215519 |
| Molecular Formula | C8H13ClN2 |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | N-(3-chloropropyl)-N-methyl-1H-pyrrol-2-amine |
| SMILES | CN(CCCCl)c1ccc[nH]1 |
| InChI | InChI=1S/C8H13ClN2/c1-11(7-3-5-9)8-4-2-6-10-8/h2,4,6,10H,3,5,7H2,1H3 |
| InChIKey | AHEWFTQKLVHGCI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|