C16H31N3 — CID 71575889
N,N-dimethyl-N'-octyl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine (PubChem CID 71575889) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is N,N-dimethyl-N'-octyl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine.
| Compound Name | N,N-dimethyl-N'-octyl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 71575889 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | N,N-dimethyl-N'-octyl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine |
| SMILES | CCCCCCCCN(CCN(C)C)c1ccc[nH]1 |
| InChI | InChI=1S/C16H31N3/c1-4-5-6-7-8-9-13-19(15-14-18(2)3)16-11-10-12-17-16/h10-12,17H,4-9,13-15H2,1-3H3 |
| InChIKey | MEDSEZLECVRHAC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|