C13H18N2O2 — CID 115216559
2-[[2-(1,3-benzoxazol-6-yl)-2-methylpropyl]amino]ethanol (PubChem CID 115216559) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-[[2-(1,3-benzoxazol-6-yl)-2-methylpropyl]amino]ethanol.
| Compound Name | 2-[[2-(1,3-benzoxazol-6-yl)-2-methylpropyl]amino]ethanol |
|---|---|
| PubChem CID | 115216559 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-[[2-(1,3-benzoxazol-6-yl)-2-methylpropyl]amino]ethanol |
| SMILES | CC(C)(CNCCO)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C13H18N2O2/c1-13(2,8-14-5-6-16)10-3-4-11-12(7-10)17-9-15-11/h3-4,7,9,14,16H,5-6,8H2,1-2H3 |
| InChIKey | XWHRWKAWPOWDGI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|