C13H22N2O3 — CID 11521686
methyl 1,2,2,3,3,7a-hexamethylimidazo[1,2-b][1,2]oxazole-7-carboxylate (PubChem CID 11521686) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl 1,2,2,3,3,7a-hexamethylimidazo[1,2-b][1,2]oxazole-7-carboxylate.
| Compound Name | methyl 1,2,2,3,3,7a-hexamethylimidazo[1,2-b][1,2]oxazole-7-carboxylate |
|---|---|
| PubChem CID | 11521686 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | methyl 1,2,2,3,3,7a-hexamethylimidazo[1,2-b][1,2]oxazole-7-carboxylate |
| SMILES | COC(=O)C1=CON2C1(C)N(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C13H22N2O3/c1-11(2)12(3,4)15-13(5,14(11)6)9(8-18-15)10(16)17-7/h8H,1-7H3 |
| InChIKey | QAKHZPXVPUKEQA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |