C16H28N2O3 — CID 11493107
methyl 7a-tert-butyl-1,2,2,3,3-pentamethylimidazo[1,2-b][1,2]oxazole-7-carboxylate (PubChem CID 11493107) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is methyl 7a-tert-butyl-1,2,2,3,3-pentamethylimidazo[1,2-b][1,2]oxazole-7-carboxylate.
| Compound Name | methyl 7a-tert-butyl-1,2,2,3,3-pentamethylimidazo[1,2-b][1,2]oxazole-7-carboxylate |
|---|---|
| PubChem CID | 11493107 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | methyl 7a-tert-butyl-1,2,2,3,3-pentamethylimidazo[1,2-b][1,2]oxazole-7-carboxylate |
| SMILES | COC(=O)C1=CON2C(C)(C)C(C)(C)N(C)C12C(C)(C)C |
| InChI | InChI=1S/C16H28N2O3/c1-13(2,3)16-11(12(19)20-9)10-21-18(16)15(6,7)14(4,5)17(16)8/h10H,1-9H3 |
| InChIKey | IJKZQJVPSHQADL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |