C15H22N2O — CID 115217783
4-[2-(1-methylindol-3-yl)ethylamino]butan-1-ol (PubChem CID 115217783) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-[2-(1-methylindol-3-yl)ethylamino]butan-1-ol.
| Compound Name | 4-[2-(1-methylindol-3-yl)ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 115217783 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 4-[2-(1-methylindol-3-yl)ethylamino]butan-1-ol |
| SMILES | Cn1cc(CCNCCCCO)c2ccccc21 |
| InChI | InChI=1S/C15H22N2O/c1-17-12-13(8-10-16-9-4-5-11-18)14-6-2-3-7-15(14)17/h2-3,6-7,12,16,18H,4-5,8-11H2,1H3 |
| InChIKey | AZAFEBOXHOUOBY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|