C14H21NO2S — CID 115219449
2-methyl-3-[(4-propan-2-ylsulfanylphenyl)methylamino]propanoic acid (PubChem CID 115219449) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-methyl-3-[(4-propan-2-ylsulfanylphenyl)methylamino]propanoic acid.
| Compound Name | 2-methyl-3-[(4-propan-2-ylsulfanylphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 115219449 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-methyl-3-[(4-propan-2-ylsulfanylphenyl)methylamino]propanoic acid |
| SMILES | CC(C)Sc1ccc(CNCC(C)C(=O)O)cc1 |
| InChI | InChI=1S/C14H21NO2S/c1-10(2)18-13-6-4-12(5-7-13)9-15-8-11(3)14(16)17/h4-7,10-11,15H,8-9H2,1-3H3,(H,16,17) |
| InChIKey | VUBXICCZNUYWEO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |