C18H24N2 — CID 115222121
1-N,2-N,2-trimethyl-1-N-(4-phenylphenyl)propane-1,2-diamine (PubChem CID 115222121) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-N,2-N,2-trimethyl-1-N-(4-phenylphenyl)propane-1,2-diamine.
| Compound Name | 1-N,2-N,2-trimethyl-1-N-(4-phenylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 115222121 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1-N,2-N,2-trimethyl-1-N-(4-phenylphenyl)propane-1,2-diamine |
| SMILES | CNC(C)(C)CN(C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H24N2/c1-18(2,19-3)14-20(4)17-12-10-16(11-13-17)15-8-6-5-7-9-15/h5-13,19H,14H2,1-4H3 |
| InChIKey | XIMFZJPLCUWFPC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |