C11H16ClNOS — CID 115223816
2-(5-chloro-2-methoxy-N,3-dimethylanilino)ethanethiol (PubChem CID 115223816) has the molecular formula C11H16ClNOS and a molecular weight of 245.77 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N,3-dimethylanilino)ethanethiol.
| Compound Name | 2-(5-chloro-2-methoxy-N,3-dimethylanilino)ethanethiol |
|---|---|
| PubChem CID | 115223816 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N,3-dimethylanilino)ethanethiol |
| SMILES | COc1c(C)cc(Cl)cc1N(C)CCS |
| InChI | InChI=1S/C11H16ClNOS/c1-8-6-9(12)7-10(11(8)14-3)13(2)4-5-15/h6-7,15H,4-5H2,1-3H3 |
| InChIKey | LDVLRKWLUSFQAY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|