C12H18ClNO2 — CID 115216751
3-(5-chloro-2-methoxy-N,3-dimethylanilino)propan-1-ol (PubChem CID 115216751) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxy-N,3-dimethylanilino)propan-1-ol.
| Compound Name | 3-(5-chloro-2-methoxy-N,3-dimethylanilino)propan-1-ol |
|---|---|
| PubChem CID | 115216751 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-(5-chloro-2-methoxy-N,3-dimethylanilino)propan-1-ol |
| SMILES | COc1c(C)cc(Cl)cc1N(C)CCCO |
| InChI | InChI=1S/C12H18ClNO2/c1-9-7-10(13)8-11(12(9)16-3)14(2)5-4-6-15/h7-8,15H,4-6H2,1-3H3 |
| InChIKey | GTNXXZUBXUPESI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |