C22H21F3N4OS — CID 1152241
(2S)-N-[4-(dimethylamino)phenyl]-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide (PubChem CID 1152241) has the molecular formula C22H21F3N4OS and a molecular weight of 446.50 g/mol. Its IUPAC name is (2S)-N-[4-(dimethylamino)phenyl]-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-[4-(dimethylamino)phenyl]-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 1152241 |
| Molecular Formula | C22H21F3N4OS |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | (2S)-N-[4-(dimethylamino)phenyl]-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide |
| SMILES | C[C@H](Sc1nc(-c2ccccc2)cc(C(F)(F)F)n1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H21F3N4OS/c1-14(20(30)26-16-9-11-17(12-10-16)29(2)3)31-21-27-18(15-7-5-4-6-8-15)13-19(28-21)22(23,24)25/h4-14H,1-3H3,(H,26,30)/t14-/m0/s1 |
| InChIKey | GHNKJPCRIUOKAD-AWEZNQCLSA-N |
| XLogP | 5.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|