C21H24F3N3OS — CID 3145658
N-cyclohexyl-N-methyl-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide (PubChem CID 3145658) has the molecular formula C21H24F3N3OS and a molecular weight of 423.50 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide.
| Compound Name | N-cyclohexyl-N-methyl-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 3145658 |
| Molecular Formula | C21H24F3N3OS |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-cyclohexyl-N-methyl-2-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nc(-c2ccccc2)cc(C(F)(F)F)n1)C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C21H24F3N3OS/c1-14(19(28)27(2)16-11-7-4-8-12-16)29-20-25-17(15-9-5-3-6-10-15)13-18(26-20)21(22,23)24/h3,5-6,9-10,13-14,16H,4,7-8,11-12H2,1-2H3 |
| InChIKey | URIANYFCHDYZKF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |