C15H25NOS — CID 115224842
3-[(3-tert-butyl-4-methoxyphenyl)methylamino]propane-1-thiol (PubChem CID 115224842) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is 3-[(3-tert-butyl-4-methoxyphenyl)methylamino]propane-1-thiol.
| Compound Name | 3-[(3-tert-butyl-4-methoxyphenyl)methylamino]propane-1-thiol |
|---|---|
| PubChem CID | 115224842 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 3-[(3-tert-butyl-4-methoxyphenyl)methylamino]propane-1-thiol |
| SMILES | COc1ccc(CNCCCS)cc1C(C)(C)C |
| InChI | InChI=1S/C15H25NOS/c1-15(2,3)13-10-12(6-7-14(13)17-4)11-16-8-5-9-18/h6-7,10,16,18H,5,8-9,11H2,1-4H3 |
| InChIKey | PVQVZIXLAUAZQM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|