C14H24N2 — CID 115226401
N'-[2-methyl-2-(2,4,5-trimethylphenyl)propyl]methanediamine (PubChem CID 115226401) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N'-[2-methyl-2-(2,4,5-trimethylphenyl)propyl]methanediamine.
| Compound Name | N'-[2-methyl-2-(2,4,5-trimethylphenyl)propyl]methanediamine |
|---|---|
| PubChem CID | 115226401 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N'-[2-methyl-2-(2,4,5-trimethylphenyl)propyl]methanediamine |
| SMILES | Cc1cc(C)c(C(C)(C)CNCN)cc1C |
| InChI | InChI=1S/C14H24N2/c1-10-6-12(3)13(7-11(10)2)14(4,5)8-16-9-15/h6-7,16H,8-9,15H2,1-5H3 |
| InChIKey | WGBLPGRFLHEQKG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|