C15H26N2O — CID 115226397
N'-[2-(4-methoxy-2,3,5-trimethylphenyl)-2-methylpropyl]methanediamine (PubChem CID 115226397) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is N'-[2-(4-methoxy-2,3,5-trimethylphenyl)-2-methylpropyl]methanediamine.
| Compound Name | N'-[2-(4-methoxy-2,3,5-trimethylphenyl)-2-methylpropyl]methanediamine |
|---|---|
| PubChem CID | 115226397 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | N'-[2-(4-methoxy-2,3,5-trimethylphenyl)-2-methylpropyl]methanediamine |
| SMILES | COc1c(C)cc(C(C)(C)CNCN)c(C)c1C |
| InChI | InChI=1S/C15H26N2O/c1-10-7-13(15(4,5)8-17-9-16)11(2)12(3)14(10)18-6/h7,17H,8-9,16H2,1-6H3 |
| InChIKey | UETWJKTXSAFJEX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|