C13H22N2O — CID 116855587
2-(4-methoxy-2,3,5-trimethylphenyl)propane-1,2-diamine (PubChem CID 116855587) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-(4-methoxy-2,3,5-trimethylphenyl)propane-1,2-diamine.
| Compound Name | 2-(4-methoxy-2,3,5-trimethylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 116855587 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-(4-methoxy-2,3,5-trimethylphenyl)propane-1,2-diamine |
| SMILES | COc1c(C)cc(C(C)(N)CN)c(C)c1C |
| InChI | InChI=1S/C13H22N2O/c1-8-6-11(13(4,15)7-14)9(2)10(3)12(8)16-5/h6H,7,14-15H2,1-5H3 |
| InChIKey | BSAFQGVWVCYCEQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |