About N'-(2-bromophenyl)-N,N'-dimethylmethanediamine
N'-(2-bromophenyl)-N,N'-dimethylmethanediamine (PubChem CID 115226768) has the molecular formula C9H13BrN2
and a molecular weight of 229.12 g/mol. Its IUPAC name is N'-(2-bromophenyl)-N,N'-dimethylmethanediamine.
Molecular Properties
| Compound Name | N'-(2-bromophenyl)-N,N'-dimethylmethanediamine |
| PubChem CID | 115226768 |
| Molecular Formula | C9H13BrN2 |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | N'-(2-bromophenyl)-N,N'-dimethylmethanediamine |
| SMILES | CNCN(C)c1ccccc1Br |
| InChI | InChI=1S/C9H13BrN2/c1-11-7-12(2)9-6-4-3-5-8(9)10/h3-6,11H,7H2,1-2H3 |
| InChIKey | ZCLOSYFQNYRZTL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-bromophenyl)-N,N'-dimethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-bromophenyl)-N,N'-dimethylmethanediamine?
The IUPAC name of N'-(2-bromophenyl)-N,N'-dimethylmethanediamine (CID 115226768) is N'-(2-bromophenyl)-N,N'-dimethylmethanediamine.
What is the SMILES notation for N'-(2-bromophenyl)-N,N'-dimethylmethanediamine?
The canonical SMILES for N'-(2-bromophenyl)-N,N'-dimethylmethanediamine is CNCN(C)c1ccccc1Br.
What is the InChIKey of N'-(2-bromophenyl)-N,N'-dimethylmethanediamine?
The InChIKey is ZCLOSYFQNYRZTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN2/c1-11-7-12(2)9-6-4-3-5-8(9)10/h3-6,11H,7H2,1-2H3.
What are the key properties of N'-(2-bromophenyl)-N,N'-dimethylmethanediamine?
N'-(2-bromophenyl)-N,N'-dimethylmethanediamine has a molecular weight of 229.12 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-bromophenyl)-N,N'-dimethylmethanediamine is sourced from PubChem (CID 115226768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).