C9H13BrN2 — CID 115226768
N'-(2-bromophenyl)-N,N'-dimethylmethanediamine (PubChem CID 115226768) has the molecular formula C9H13BrN2 and a molecular weight of 229.12 g/mol. Its IUPAC name is N'-(2-bromophenyl)-N,N'-dimethylmethanediamine.
| Compound Name | N'-(2-bromophenyl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 115226768 |
| Molecular Formula | C9H13BrN2 |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | N'-(2-bromophenyl)-N,N'-dimethylmethanediamine |
| SMILES | CNCN(C)c1ccccc1Br |
| InChI | InChI=1S/C9H13BrN2/c1-11-7-12(2)9-6-4-3-5-8(9)10/h3-6,11H,7H2,1-2H3 |
| InChIKey | ZCLOSYFQNYRZTL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|