C11H15NO3 — CID 115229229
[methyl-[(6-methyl-1,3-benzodioxol-5-yl)methyl]amino]methanol (PubChem CID 115229229) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is [methyl-[(6-methyl-1,3-benzodioxol-5-yl)methyl]amino]methanol.
| Compound Name | [methyl-[(6-methyl-1,3-benzodioxol-5-yl)methyl]amino]methanol |
|---|---|
| PubChem CID | 115229229 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | [methyl-[(6-methyl-1,3-benzodioxol-5-yl)methyl]amino]methanol |
| SMILES | Cc1cc2c(cc1CN(C)CO)OCO2 |
| InChI | InChI=1S/C11H15NO3/c1-8-3-10-11(15-7-14-10)4-9(8)5-12(2)6-13/h3-4,13H,5-7H2,1-2H3 |
| InChIKey | HWWNDUKEMDGPLT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|