C12H19NO — CID 115229232
[methyl-[(2,3,4-trimethylphenyl)methyl]amino]methanol (PubChem CID 115229232) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is [methyl-[(2,3,4-trimethylphenyl)methyl]amino]methanol.
| Compound Name | [methyl-[(2,3,4-trimethylphenyl)methyl]amino]methanol |
|---|---|
| PubChem CID | 115229232 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | [methyl-[(2,3,4-trimethylphenyl)methyl]amino]methanol |
| SMILES | Cc1ccc(CN(C)CO)c(C)c1C |
| InChI | InChI=1S/C12H19NO/c1-9-5-6-12(7-13(4)8-14)11(3)10(9)2/h5-6,14H,7-8H2,1-4H3 |
| InChIKey | SKZZIRFSIUYEFM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|