C17H31NO6 — CID 11523062
diethyl 2-methyl-2-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]propanedioate (PubChem CID 11523062) has the molecular formula C17H31NO6 and a molecular weight of 345.44 g/mol. Its IUPAC name is diethyl 2-methyl-2-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]propanedioate.
| Compound Name | diethyl 2-methyl-2-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]propanedioate |
|---|---|
| PubChem CID | 11523062 |
| Molecular Formula | C17H31NO6 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | diethyl 2-methyl-2-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]propanedioate |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H31NO6/c1-9-22-13(19)17(8,14(20)23-10-2)12(11(3)4)18-15(21)24-16(5,6)7/h11-12H,9-10H2,1-8H3,(H,18,21) |
| InChIKey | YBYZRWYTZIHVGK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|