C20H21F3N2 — CID 11523077
(1S,2R,5S)-5-(1,3-dihydroisoindol-2-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine (PubChem CID 11523077) has the molecular formula C20H21F3N2 and a molecular weight of 346.40 g/mol. Its IUPAC name is (1S,2R,5S)-5-(1,3-dihydroisoindol-2-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine.
| Compound Name | (1S,2R,5S)-5-(1,3-dihydroisoindol-2-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 11523077 |
| Molecular Formula | C20H21F3N2 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (1S,2R,5S)-5-(1,3-dihydroisoindol-2-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3ccccc3C2)CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H21F3N2/c21-17-9-19(23)18(22)8-16(17)15-6-5-14(7-20(15)24)25-10-12-3-1-2-4-13(12)11-25/h1-4,8-9,14-15,20H,5-7,10-11,24H2/t14-,15+,20-/m0/s1 |
| InChIKey | HODJCMYQBLFCSM-MDOVXXIYSA-N |
| XLogP | 4.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|