C16H24N2O — CID 115232083
4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl-methylamino]butanenitrile (PubChem CID 115232083) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl-methylamino]butanenitrile.
| Compound Name | 4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl-methylamino]butanenitrile |
|---|---|
| PubChem CID | 115232083 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4-[2-(4-methoxy-3,5-dimethylphenyl)ethyl-methylamino]butanenitrile |
| SMILES | COc1c(C)cc(CCN(C)CCCC#N)cc1C |
| InChI | InChI=1S/C16H24N2O/c1-13-11-15(12-14(2)16(13)19-4)7-10-18(3)9-6-5-8-17/h11-12H,5-7,9-10H2,1-4H3 |
| InChIKey | NNWHSWIZEVZPSO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|