C16H24N2 — CID 115232107
4-[[2-(3,4-dimethylphenyl)-2-methylpropyl]amino]butanenitrile (PubChem CID 115232107) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 4-[[2-(3,4-dimethylphenyl)-2-methylpropyl]amino]butanenitrile.
| Compound Name | 4-[[2-(3,4-dimethylphenyl)-2-methylpropyl]amino]butanenitrile |
|---|---|
| PubChem CID | 115232107 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 4-[[2-(3,4-dimethylphenyl)-2-methylpropyl]amino]butanenitrile |
| SMILES | Cc1ccc(C(C)(C)CNCCCC#N)cc1C |
| InChI | InChI=1S/C16H24N2/c1-13-7-8-15(11-14(13)2)16(3,4)12-18-10-6-5-9-17/h7-8,11,18H,5-6,10,12H2,1-4H3 |
| InChIKey | MCBYBSMZFJHMFA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|