C17H26N2 — CID 115231309
3-[[2-(4-tert-butylphenyl)-2-methylpropyl]amino]propanenitrile (PubChem CID 115231309) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 3-[[2-(4-tert-butylphenyl)-2-methylpropyl]amino]propanenitrile.
| Compound Name | 3-[[2-(4-tert-butylphenyl)-2-methylpropyl]amino]propanenitrile |
|---|---|
| PubChem CID | 115231309 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 3-[[2-(4-tert-butylphenyl)-2-methylpropyl]amino]propanenitrile |
| SMILES | CC(C)(C)c1ccc(C(C)(C)CNCCC#N)cc1 |
| InChI | InChI=1S/C17H26N2/c1-16(2,3)14-7-9-15(10-8-14)17(4,5)13-19-12-6-11-18/h7-10,19H,6,12-13H2,1-5H3 |
| InChIKey | IOFNWMVSUXUCEO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|