C15H22N2S — CID 115231368
3-[[2-(4-ethylsulfanylphenyl)-2-methylpropyl]amino]propanenitrile (PubChem CID 115231368) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 3-[[2-(4-ethylsulfanylphenyl)-2-methylpropyl]amino]propanenitrile.
| Compound Name | 3-[[2-(4-ethylsulfanylphenyl)-2-methylpropyl]amino]propanenitrile |
|---|---|
| PubChem CID | 115231368 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3-[[2-(4-ethylsulfanylphenyl)-2-methylpropyl]amino]propanenitrile |
| SMILES | CCSc1ccc(C(C)(C)CNCCC#N)cc1 |
| InChI | InChI=1S/C15H22N2S/c1-4-18-14-8-6-13(7-9-14)15(2,3)12-17-11-5-10-16/h6-9,17H,4-5,11-12H2,1-3H3 |
| InChIKey | DKCJKPRHTRPIBV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|