C14H20N2S — CID 115131542
2-[[2-(4-ethylsulfanylphenyl)-2-methylpropyl]amino]acetonitrile (PubChem CID 115131542) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 2-[[2-(4-ethylsulfanylphenyl)-2-methylpropyl]amino]acetonitrile.
| Compound Name | 2-[[2-(4-ethylsulfanylphenyl)-2-methylpropyl]amino]acetonitrile |
|---|---|
| PubChem CID | 115131542 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-[[2-(4-ethylsulfanylphenyl)-2-methylpropyl]amino]acetonitrile |
| SMILES | CCSc1ccc(C(C)(C)CNCC#N)cc1 |
| InChI | InChI=1S/C14H20N2S/c1-4-17-13-7-5-12(6-8-13)14(2,3)11-16-10-9-15/h5-8,16H,4,10-11H2,1-3H3 |
| InChIKey | PIOQFTKCSGHXIN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|