C16H14ClN5OS — CID 11523340
N-(2-chloro-4-pyridinyl)-2-methyl-5-[(4-methyl-3-pyridinyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 11523340) has the molecular formula C16H14ClN5OS and a molecular weight of 359.84 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-2-methyl-5-[(4-methyl-3-pyridinyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-2-methyl-5-[(4-methyl-3-pyridinyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 11523340 |
| Molecular Formula | C16H14ClN5OS |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-2-methyl-5-[(4-methyl-3-pyridinyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccnc(Cl)c2)c(Nc2cnccc2C)s1 |
| InChI | InChI=1S/C16H14ClN5OS/c1-9-3-5-18-8-12(9)22-16-14(20-10(2)24-16)15(23)21-11-4-6-19-13(17)7-11/h3-8,22H,1-2H3,(H,19,21,23) |
| InChIKey | IKUXVXQZBPLHLZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|